C21H27N5O3S — CID 144697454
4-cyclopropyloxy-2-[2-(4-methylsulfonyl-1,4-diazepan-1-yl)pyridine-4-carboximidoyl]aniline (PubChem CID 144697454) has the molecular formula C21H27N5O3S and a molecular weight of 429.55 g/mol. Its IUPAC name is 4-cyclopropyloxy-2-[2-(4-methylsulfonyl-1,4-diazepan-1-yl)pyridine-4-carboximidoyl]aniline.
| Compound Name | 4-cyclopropyloxy-2-[2-(4-methylsulfonyl-1,4-diazepan-1-yl)pyridine-4-carboximidoyl]aniline |
|---|---|
| PubChem CID | 144697454 |
| Molecular Formula | C21H27N5O3S |
| Molecular Weight | 429.55 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | 4-cyclopropyloxy-2-[2-(4-methylsulfonyl-1,4-diazepan-1-yl)pyridine-4-carboximidoyl]aniline |
| SMILES | [H]/N=C(/c1ccnc(N2CCCN(S(C)(=O)=O)CC2)c1)c1cc(OC2CC2)ccc1N |
| InChI | InChI=1S/C21H27N5O3S/c1-30(27,28)26-10-2-9-25(11-12-26)20-13-15(7-8-24-20)21(23)18-14-17(5-6-19(18)22)29-16-3-4-16/h5-8,13-14,16,23H,2-4,9-12,22H2,1H3/b23-21- |
| InChIKey | VNDRLLVXLFUDLM-LNVKXUELSA-N |
| XLogP | 2.09 |
| TPSA | 112.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.55 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|