C19H26N4OS — CID 144697556
molecular hydrogen;4-propan-2-yloxy-2-(2-thiomorpholin-4-ylpyridine-4-carboximidoyl)aniline (PubChem CID 144697556) has the molecular formula C19H26N4OS and a molecular weight of 358.51 g/mol. Its IUPAC name is molecular hydrogen;4-propan-2-yloxy-2-(2-thiomorpholin-4-ylpyridine-4-carboximidoyl)aniline.
| Compound Name | molecular hydrogen;4-propan-2-yloxy-2-(2-thiomorpholin-4-ylpyridine-4-carboximidoyl)aniline |
|---|---|
| PubChem CID | 144697556 |
| Molecular Formula | C19H26N4OS |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | molecular hydrogen;4-propan-2-yloxy-2-(2-thiomorpholin-4-ylpyridine-4-carboximidoyl)aniline |
| SMILES | [H]/N=C(\c1ccnc(N2CCSCC2)c1)c1cc(OC(C)C)ccc1N.[H][H] |
| InChI | InChI=1S/C19H24N4OS.H2/c1-13(2)24-15-3-4-17(20)16(12-15)19(21)14-5-6-22-18(11-14)23-7-9-25-10-8-23;/h3-6,11-13,21H,7-10,20H2,1-2H3;1H/b21-19+; |
| InChIKey | QPGCWMUMLWQLDU-UXJRWBAGSA-N |
| XLogP | 3.67 |
| TPSA | 75.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|