C23H23Cl2N5OS — CID 164566041
4-[(1R)-1-(3,5-dichloro-4-pyridinyl)ethoxy]-2-(6-thiomorpholin-4-ylpyridine-3-carboximidoyl)aniline (PubChem CID 164566041) has the molecular formula C23H23Cl2N5OS and a molecular weight of 488.44 g/mol. Its IUPAC name is 4-[(1R)-1-(3,5-dichloro-4-pyridinyl)ethoxy]-2-(6-thiomorpholin-4-ylpyridine-3-carboximidoyl)aniline.
| Compound Name | 4-[(1R)-1-(3,5-dichloro-4-pyridinyl)ethoxy]-2-(6-thiomorpholin-4-ylpyridine-3-carboximidoyl)aniline |
|---|---|
| PubChem CID | 164566041 |
| Molecular Formula | C23H23Cl2N5OS |
| Molecular Weight | 488.44 g/mol |
| Exact Mass | 487.10 |
| IUPAC Name | 4-[(1R)-1-(3,5-dichloro-4-pyridinyl)ethoxy]-2-(6-thiomorpholin-4-ylpyridine-3-carboximidoyl)aniline |
| SMILES | [H]/N=C(\c1ccc(N2CCSCC2)nc1)c1cc(O[C@H](C)c2c(Cl)cncc2Cl)ccc1N |
| InChI | InChI=1S/C23H23Cl2N5OS/c1-14(22-18(24)12-28-13-19(22)25)31-16-3-4-20(26)17(10-16)23(27)15-2-5-21(29-11-15)30-6-8-32-9-7-30/h2-5,10-14,27H,6-9,26H2,1H3/b27-23+/t14-/m1/s1 |
| InChIKey | DVIFGHPWXQCCBL-UKWFWIHTSA-N |
| XLogP | 5.47 |
| TPSA | 88.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.44 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|