C24H27Cl2N5OS — CID 156804645
5-[2-amino-5-[(1R)-1-(3,5-dichloro-2-methyl-4-pyridinyl)ethoxy]benzenecarboximidoyl]pyridin-2-amine;thiolane (PubChem CID 156804645) has the molecular formula C24H27Cl2N5OS and a molecular weight of 504.49 g/mol. Its IUPAC name is 5-[2-amino-5-[(1R)-1-(3,5-dichloro-2-methyl-4-pyridinyl)ethoxy]benzenecarboximidoyl]pyridin-2-amine;thiolane.
| Compound Name | 5-[2-amino-5-[(1R)-1-(3,5-dichloro-2-methyl-4-pyridinyl)ethoxy]benzenecarboximidoyl]pyridin-2-amine;thiolane |
|---|---|
| PubChem CID | 156804645 |
| Molecular Formula | C24H27Cl2N5OS |
| Molecular Weight | 504.49 g/mol |
| Exact Mass | 503.13 |
| IUPAC Name | 5-[2-amino-5-[(1R)-1-(3,5-dichloro-2-methyl-4-pyridinyl)ethoxy]benzenecarboximidoyl]pyridin-2-amine;thiolane |
| SMILES | C1CCSC1.[H]/N=C(\c1ccc(N)nc1)c1cc(O[C@H](C)c2c(Cl)cnc(C)c2Cl)ccc1N |
| InChI | InChI=1S/C20H19Cl2N5O.C4H8S/c1-10-19(22)18(15(21)9-26-10)11(2)28-13-4-5-16(23)14(7-13)20(25)12-3-6-17(24)27-8-12;1-2-4-5-3-1/h3-9,11,25H,23H2,1-2H3,(H2,24,27);1-4H2/b25-20+;/t11-;/m1./s1 |
| InChIKey | XCKKRWVGKOGEFL-PPZGAKIISA-N |
| XLogP | 6.33 |
| TPSA | 110.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.49 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|