C25H25Cl2FN6O3 — CID 167156297
methyl 4-[5-[2-amino-5-[(1R)-1-(3,5-dichloro-2-fluoro-4-pyridinyl)ethoxy]benzenecarboximidoyl]-2-pyridinyl]piperazine-1-carboxylate (PubChem CID 167156297) has the molecular formula C25H25Cl2FN6O3 and a molecular weight of 547.42 g/mol. Its IUPAC name is methyl 4-[5-[2-amino-5-[(1R)-1-(3,5-dichloro-2-fluoro-4-pyridinyl)ethoxy]benzenecarboximidoyl]-2-pyridinyl]piperazine-1-carboxylate.
| Compound Name | methyl 4-[5-[2-amino-5-[(1R)-1-(3,5-dichloro-2-fluoro-4-pyridinyl)ethoxy]benzenecarboximidoyl]-2-pyridinyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 167156297 |
| Molecular Formula | C25H25Cl2FN6O3 |
| Molecular Weight | 547.42 g/mol |
| Exact Mass | 546.13 |
| IUPAC Name | methyl 4-[5-[2-amino-5-[(1R)-1-(3,5-dichloro-2-fluoro-4-pyridinyl)ethoxy]benzenecarboximidoyl]-2-pyridinyl]piperazine-1-carboxylate |
| SMILES | [H]/N=C(\c1ccc(N2CCN(C(=O)OC)CC2)nc1)c1cc(O[C@H](C)c2c(Cl)cnc(F)c2Cl)ccc1N |
| InChI | InChI=1S/C25H25Cl2FN6O3/c1-14(21-18(26)13-32-24(28)22(21)27)37-16-4-5-19(29)17(11-16)23(30)15-3-6-20(31-12-15)33-7-9-34(10-8-33)25(35)36-2/h3-6,11-14,30H,7-10,29H2,1-2H3/b30-23+/t14-/m1/s1 |
| InChIKey | PDZIYNHUHDGJGN-GMRHKKJLSA-N |
| XLogP | 4.95 |
| TPSA | 117.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.42 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|