C28H32Cl2FN6O2P — CID 170708736
4-[(1R)-1-(3,5-dichloro-4-pyridinyl)ethoxy]-2-[5-fluoro-6-[3-methyl-3-(4-methyl-4-oxo-1,4λ5-azaphosphinan-1-yl)azetidin-1-yl]pyridine-3-carboximidoyl]aniline (PubChem CID 170708736) has the molecular formula C28H32Cl2FN6O2P and a molecular weight of 605.48 g/mol. Its IUPAC name is 4-[(1R)-1-(3,5-dichloro-4-pyridinyl)ethoxy]-2-[5-fluoro-6-[3-methyl-3-(4-methyl-4-oxo-1,4λ5-azaphosphinan-1-yl)azetidin-1-yl]pyridine-3-carboximidoyl]aniline.
| Compound Name | 4-[(1R)-1-(3,5-dichloro-4-pyridinyl)ethoxy]-2-[5-fluoro-6-[3-methyl-3-(4-methyl-4-oxo-1,4λ5-azaphosphinan-1-yl)azetidin-1-yl]pyridine-3-carboximidoyl]aniline |
|---|---|
| PubChem CID | 170708736 |
| Molecular Formula | C28H32Cl2FN6O2P |
| Molecular Weight | 605.48 g/mol |
| Exact Mass | 604.17 |
| IUPAC Name | 4-[(1R)-1-(3,5-dichloro-4-pyridinyl)ethoxy]-2-[5-fluoro-6-[3-methyl-3-(4-methyl-4-oxo-1,4λ5-azaphosphinan-1-yl)azetidin-1-yl]pyridine-3-carboximidoyl]aniline |
| SMILES | [H]/N=C(\c1cnc(N2CC(C)(N3CCP(C)(=O)CC3)C2)c(F)c1)c1cc(O[C@H](C)c2c(Cl)cncc2Cl)ccc1N |
| InChI | InChI=1S/C28H32Cl2FN6O2P/c1-17(25-21(29)13-34-14-22(25)30)39-19-4-5-24(32)20(11-19)26(33)18-10-23(31)27(35-12-18)36-15-28(2,16-36)37-6-8-40(3,38)9-7-37/h4-5,10-14,17,33H,6-9,15-16,32H2,1-3H3/b33-26+/t17-/m1/s1 |
| InChIKey | UZSKASYMEUDBOE-QJFJUWHXSA-N |
| XLogP | 5.95 |
| TPSA | 108.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.48 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|