C22H23Cl2N7O — CID 170708569
1-[6-[2-amino-5-[(1R)-1-(3,5-dichloro-4-pyridinyl)ethoxy]benzenecarboximidoyl]pyridazin-3-yl]-3-methylazetidin-3-amine (PubChem CID 170708569) has the molecular formula C22H23Cl2N7O and a molecular weight of 472.38 g/mol. Its IUPAC name is 1-[6-[2-amino-5-[(1R)-1-(3,5-dichloro-4-pyridinyl)ethoxy]benzenecarboximidoyl]pyridazin-3-yl]-3-methylazetidin-3-amine.
| Compound Name | 1-[6-[2-amino-5-[(1R)-1-(3,5-dichloro-4-pyridinyl)ethoxy]benzenecarboximidoyl]pyridazin-3-yl]-3-methylazetidin-3-amine |
|---|---|
| PubChem CID | 170708569 |
| Molecular Formula | C22H23Cl2N7O |
| Molecular Weight | 472.38 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | 1-[6-[2-amino-5-[(1R)-1-(3,5-dichloro-4-pyridinyl)ethoxy]benzenecarboximidoyl]pyridazin-3-yl]-3-methylazetidin-3-amine |
| SMILES | [H]/N=C(\c1ccc(N2CC(C)(N)C2)nn1)c1cc(O[C@H](C)c2c(Cl)cncc2Cl)ccc1N |
| InChI | InChI=1S/C22H23Cl2N7O/c1-12(20-15(23)8-28-9-16(20)24)32-13-3-4-17(25)14(7-13)21(26)18-5-6-19(30-29-18)31-10-22(2,27)11-31/h3-9,12,26H,10-11,25,27H2,1-2H3/b26-21-/t12-/m1/s1 |
| InChIKey | NOHDWPTWXXMMKX-ZNGLMUNFSA-N |
| XLogP | 3.85 |
| TPSA | 127.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.38 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|