C26H26Cl2N8O — CID 170708727
4-[(1R)-1-(3,5-dichloro-4-pyridinyl)ethoxy]-2-[6-[3-(2-methylpyrazol-3-yl)pyrrolidin-1-yl]pyridazine-3-carboximidoyl]aniline (PubChem CID 170708727) has the molecular formula C26H26Cl2N8O and a molecular weight of 537.46 g/mol. Its IUPAC name is 4-[(1R)-1-(3,5-dichloro-4-pyridinyl)ethoxy]-2-[6-[3-(2-methylpyrazol-3-yl)pyrrolidin-1-yl]pyridazine-3-carboximidoyl]aniline.
| Compound Name | 4-[(1R)-1-(3,5-dichloro-4-pyridinyl)ethoxy]-2-[6-[3-(2-methylpyrazol-3-yl)pyrrolidin-1-yl]pyridazine-3-carboximidoyl]aniline |
|---|---|
| PubChem CID | 170708727 |
| Molecular Formula | C26H26Cl2N8O |
| Molecular Weight | 537.46 g/mol |
| Exact Mass | 536.16 |
| IUPAC Name | 4-[(1R)-1-(3,5-dichloro-4-pyridinyl)ethoxy]-2-[6-[3-(2-methylpyrazol-3-yl)pyrrolidin-1-yl]pyridazine-3-carboximidoyl]aniline |
| SMILES | [H]/N=C(\c1ccc(N2CCC(c3ccnn3C)C2)nn1)c1cc(O[C@H](C)c2c(Cl)cncc2Cl)ccc1N |
| InChI | InChI=1S/C26H26Cl2N8O/c1-15(25-19(27)12-31-13-20(25)28)37-17-3-4-21(29)18(11-17)26(30)22-5-6-24(34-33-22)36-10-8-16(14-36)23-7-9-32-35(23)2/h3-7,9,11-13,15-16,30H,8,10,14,29H2,1-2H3/b30-26-/t15-,16?/m1/s1 |
| InChIKey | NAXUCYYIISFKND-NERMCABCSA-N |
| XLogP | 5.04 |
| TPSA | 118.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.46 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|