C24H26Cl2N6O — CID 177139646
4-[(1R)-1-(3,5-dichloro-4-pyridinyl)ethoxy]-2-[6-(4-methylpiperazin-1-yl)pyridine-3-carboximidoyl]aniline (PubChem CID 177139646) has the molecular formula C24H26Cl2N6O and a molecular weight of 485.42 g/mol. Its IUPAC name is 4-[(1R)-1-(3,5-dichloro-4-pyridinyl)ethoxy]-2-[6-(4-methylpiperazin-1-yl)pyridine-3-carboximidoyl]aniline.
| Compound Name | 4-[(1R)-1-(3,5-dichloro-4-pyridinyl)ethoxy]-2-[6-(4-methylpiperazin-1-yl)pyridine-3-carboximidoyl]aniline |
|---|---|
| PubChem CID | 177139646 |
| Molecular Formula | C24H26Cl2N6O |
| Molecular Weight | 485.42 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | 4-[(1R)-1-(3,5-dichloro-4-pyridinyl)ethoxy]-2-[6-(4-methylpiperazin-1-yl)pyridine-3-carboximidoyl]aniline |
| SMILES | [H]/N=C(\c1ccc(N2CCN(C)CC2)nc1)c1cc(O[C@H](C)c2c(Cl)cncc2Cl)ccc1N |
| InChI | InChI=1S/C24H26Cl2N6O/c1-15(23-19(25)13-29-14-20(23)26)33-17-4-5-21(27)18(11-17)24(28)16-3-6-22(30-12-16)32-9-7-31(2)8-10-32/h3-6,11-15,28H,7-10,27H2,1-2H3/b28-24+/t15-/m1/s1 |
| InChIKey | ZVQKZXGYUCGIAA-NMZQBJHGSA-N |
| XLogP | 4.67 |
| TPSA | 91.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.42 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|