C24H24Cl2FN5O3S — CID 167155998
4-[(1R)-1-(3,5-dichloro-4-pyridinyl)ethoxy]-5-fluoro-2-[6-[3-(methylsulfonylmethyl)azetidin-1-yl]pyridine-3-carboximidoyl]aniline (PubChem CID 167155998) has the molecular formula C24H24Cl2FN5O3S and a molecular weight of 552.46 g/mol. Its IUPAC name is 4-[(1R)-1-(3,5-dichloro-4-pyridinyl)ethoxy]-5-fluoro-2-[6-[3-(methylsulfonylmethyl)azetidin-1-yl]pyridine-3-carboximidoyl]aniline.
| Compound Name | 4-[(1R)-1-(3,5-dichloro-4-pyridinyl)ethoxy]-5-fluoro-2-[6-[3-(methylsulfonylmethyl)azetidin-1-yl]pyridine-3-carboximidoyl]aniline |
|---|---|
| PubChem CID | 167155998 |
| Molecular Formula | C24H24Cl2FN5O3S |
| Molecular Weight | 552.46 g/mol |
| Exact Mass | 551.10 |
| IUPAC Name | 4-[(1R)-1-(3,5-dichloro-4-pyridinyl)ethoxy]-5-fluoro-2-[6-[3-(methylsulfonylmethyl)azetidin-1-yl]pyridine-3-carboximidoyl]aniline |
| SMILES | [H]/N=C(\c1ccc(N2CC(CS(C)(=O)=O)C2)nc1)c1cc(O[C@H](C)c2c(Cl)cncc2Cl)c(F)cc1N |
| InChI | InChI=1S/C24H24Cl2FN5O3S/c1-13(23-17(25)8-30-9-18(23)26)35-21-5-16(20(28)6-19(21)27)24(29)15-3-4-22(31-7-15)32-10-14(11-32)12-36(2,33)34/h3-9,13-14,29H,10-12,28H2,1-2H3/b29-24+/t13-/m1/s1 |
| InChIKey | MFCCDHBDJSKZKD-BUYNPKNHSA-N |
| XLogP | 4.54 |
| TPSA | 122.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.46 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|