C24H24Cl2FN5O2 — CID 171827770
[1-[5-[2-amino-5-[(1R)-1-(3,5-dichloro-4-pyridinyl)ethoxy]benzenecarboximidoyl]-3-fluoro-2-pyridinyl]-3-methylazetidin-3-yl]methanol (PubChem CID 171827770) has the molecular formula C24H24Cl2FN5O2 and a molecular weight of 504.39 g/mol. Its IUPAC name is [1-[5-[2-amino-5-[(1R)-1-(3,5-dichloro-4-pyridinyl)ethoxy]benzenecarboximidoyl]-3-fluoro-2-pyridinyl]-3-methylazetidin-3-yl]methanol.
| Compound Name | [1-[5-[2-amino-5-[(1R)-1-(3,5-dichloro-4-pyridinyl)ethoxy]benzenecarboximidoyl]-3-fluoro-2-pyridinyl]-3-methylazetidin-3-yl]methanol |
|---|---|
| PubChem CID | 171827770 |
| Molecular Formula | C24H24Cl2FN5O2 |
| Molecular Weight | 504.39 g/mol |
| Exact Mass | 503.13 |
| IUPAC Name | [1-[5-[2-amino-5-[(1R)-1-(3,5-dichloro-4-pyridinyl)ethoxy]benzenecarboximidoyl]-3-fluoro-2-pyridinyl]-3-methylazetidin-3-yl]methanol |
| SMILES | [H]/N=C(\c1cnc(N2CC(C)(CO)C2)c(F)c1)c1cc(O[C@H](C)c2c(Cl)cncc2Cl)ccc1N |
| InChI | InChI=1S/C24H24Cl2FN5O2/c1-13(21-17(25)8-30-9-18(21)26)34-15-3-4-20(28)16(6-15)22(29)14-5-19(27)23(31-7-14)32-10-24(2,11-32)12-33/h3-9,13,29,33H,10-12,28H2,1-2H3/b29-22+/t13-/m1/s1 |
| InChIKey | XZGYPJQEDSUOIM-KBTZHFEZSA-N |
| XLogP | 4.88 |
| TPSA | 108.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.39 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|