C23H22Cl2F2N6O — CID 167156134
4-[(S)-amino-(3,5-dichloro-4-pyridinyl)methoxy]-2-[6-(3,3-dimethylazetidin-1-yl)-5-fluoropyridine-3-carboximidoyl]-5-fluoroaniline (PubChem CID 167156134) has the molecular formula C23H22Cl2F2N6O and a molecular weight of 507.37 g/mol. Its IUPAC name is 4-[(S)-amino-(3,5-dichloro-4-pyridinyl)methoxy]-2-[6-(3,3-dimethylazetidin-1-yl)-5-fluoropyridine-3-carboximidoyl]-5-fluoroaniline.
| Compound Name | 4-[(S)-amino-(3,5-dichloro-4-pyridinyl)methoxy]-2-[6-(3,3-dimethylazetidin-1-yl)-5-fluoropyridine-3-carboximidoyl]-5-fluoroaniline |
|---|---|
| PubChem CID | 167156134 |
| Molecular Formula | C23H22Cl2F2N6O |
| Molecular Weight | 507.37 g/mol |
| Exact Mass | 506.12 |
| IUPAC Name | 4-[(S)-amino-(3,5-dichloro-4-pyridinyl)methoxy]-2-[6-(3,3-dimethylazetidin-1-yl)-5-fluoropyridine-3-carboximidoyl]-5-fluoroaniline |
| SMILES | [H]/N=C(\c1cnc(N2CC(C)(C)C2)c(F)c1)c1cc(O[C@H](N)c2c(Cl)cncc2Cl)c(F)cc1N |
| InChI | InChI=1S/C23H22Cl2F2N6O/c1-23(2)9-33(10-23)22-16(27)3-11(6-32-22)20(29)12-4-18(15(26)5-17(12)28)34-21(30)19-13(24)7-31-8-14(19)25/h3-8,21,29H,9-10,28,30H2,1-2H3/b29-20+/t21-/m0/s1 |
| InChIKey | RLYICJGBCKVGRS-ZOPZMGNLSA-N |
| XLogP | 4.94 |
| TPSA | 114.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.37 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|