C23H18Cl2F3N7O — CID 167155980
5-[2-amino-5-[(S)-amino-(3,5-dichloro-4-pyridinyl)methoxy]benzenecarboximidoyl]-2-[3-(trifluoromethyl)azetidin-1-yl]pyridine-3-carbonitrile (PubChem CID 167155980) has the molecular formula C23H18Cl2F3N7O and a molecular weight of 536.35 g/mol. Its IUPAC name is 5-[2-amino-5-[(S)-amino-(3,5-dichloro-4-pyridinyl)methoxy]benzenecarboximidoyl]-2-[3-(trifluoromethyl)azetidin-1-yl]pyridine-3-carbonitrile.
| Compound Name | 5-[2-amino-5-[(S)-amino-(3,5-dichloro-4-pyridinyl)methoxy]benzenecarboximidoyl]-2-[3-(trifluoromethyl)azetidin-1-yl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 167155980 |
| Molecular Formula | C23H18Cl2F3N7O |
| Molecular Weight | 536.35 g/mol |
| Exact Mass | 535.09 |
| IUPAC Name | 5-[2-amino-5-[(S)-amino-(3,5-dichloro-4-pyridinyl)methoxy]benzenecarboximidoyl]-2-[3-(trifluoromethyl)azetidin-1-yl]pyridine-3-carbonitrile |
| SMILES | [H]/N=C(\c1cnc(N2CC(C(F)(F)F)C2)c(C#N)c1)c1cc(O[C@H](N)c2c(Cl)cncc2Cl)ccc1N |
| InChI | InChI=1S/C23H18Cl2F3N7O/c24-16-7-33-8-17(25)19(16)21(32)36-14-1-2-18(30)15(4-14)20(31)12-3-11(5-29)22(34-6-12)35-9-13(10-35)23(26,27)28/h1-4,6-8,13,21,31H,9-10,30,32H2/b31-20+/t21-/m0/s1 |
| InChIKey | OOUPBTACLQKUFL-NIKULWCKSA-N |
| XLogP | 4.69 |
| TPSA | 137.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.35 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|