C23H20Cl2N6O3 — CID 167291053
5-[2-amino-5-[(S)-amino-(3,5-dichloro-4-pyridinyl)methoxy]benzenecarboximidoyl]-2-[(3R)-oxolan-3-yl]oxypyridine-3-carbonitrile (PubChem CID 167291053) has the molecular formula C23H20Cl2N6O3 and a molecular weight of 499.36 g/mol. Its IUPAC name is 5-[2-amino-5-[(S)-amino-(3,5-dichloro-4-pyridinyl)methoxy]benzenecarboximidoyl]-2-[(3R)-oxolan-3-yl]oxypyridine-3-carbonitrile.
| Compound Name | 5-[2-amino-5-[(S)-amino-(3,5-dichloro-4-pyridinyl)methoxy]benzenecarboximidoyl]-2-[(3R)-oxolan-3-yl]oxypyridine-3-carbonitrile |
|---|---|
| PubChem CID | 167291053 |
| Molecular Formula | C23H20Cl2N6O3 |
| Molecular Weight | 499.36 g/mol |
| Exact Mass | 498.10 |
| IUPAC Name | 5-[2-amino-5-[(S)-amino-(3,5-dichloro-4-pyridinyl)methoxy]benzenecarboximidoyl]-2-[(3R)-oxolan-3-yl]oxypyridine-3-carbonitrile |
| SMILES | [H]/N=C(\c1cnc(O[C@@H]2CCOC2)c(C#N)c1)c1cc(O[C@H](N)c2c(Cl)cncc2Cl)ccc1N |
| InChI | InChI=1S/C23H20Cl2N6O3/c24-17-9-30-10-18(25)20(17)22(29)33-14-1-2-19(27)16(6-14)21(28)13-5-12(7-26)23(31-8-13)34-15-3-4-32-11-15/h1-2,5-6,8-10,15,22,28H,3-4,11,27,29H2/b28-21+/t15-,22+/m1/s1 |
| InChIKey | UICHIMAJTUQDJO-GOOPJCECSA-N |
| XLogP | 3.86 |
| TPSA | 153.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.36 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|