C26H26Cl2N6O2 — CID 166462313
5-[2-amino-5-[(3,5-dichloro-4-pyridinyl)methoxy]benzenecarboximidoyl]-2-(1-ethylpiperidin-4-yl)oxypyridine-3-carbonitrile (PubChem CID 166462313) has the molecular formula C26H26Cl2N6O2 and a molecular weight of 525.44 g/mol. Its IUPAC name is 5-[2-amino-5-[(3,5-dichloro-4-pyridinyl)methoxy]benzenecarboximidoyl]-2-(1-ethylpiperidin-4-yl)oxypyridine-3-carbonitrile.
| Compound Name | 5-[2-amino-5-[(3,5-dichloro-4-pyridinyl)methoxy]benzenecarboximidoyl]-2-(1-ethylpiperidin-4-yl)oxypyridine-3-carbonitrile |
|---|---|
| PubChem CID | 166462313 |
| Molecular Formula | C26H26Cl2N6O2 |
| Molecular Weight | 525.44 g/mol |
| Exact Mass | 524.15 |
| IUPAC Name | 5-[2-amino-5-[(3,5-dichloro-4-pyridinyl)methoxy]benzenecarboximidoyl]-2-(1-ethylpiperidin-4-yl)oxypyridine-3-carbonitrile |
| SMILES | [H]/N=C(\c1cnc(OC2CCN(CC)CC2)c(C#N)c1)c1cc(OCc2c(Cl)cncc2Cl)ccc1N |
| InChI | InChI=1S/C26H26Cl2N6O2/c1-2-34-7-5-18(6-8-34)36-26-16(11-29)9-17(12-33-26)25(31)20-10-19(3-4-24(20)30)35-15-21-22(27)13-32-14-23(21)28/h3-4,9-10,12-14,18,31H,2,5-8,15,30H2,1H3/b31-25+ |
| InChIKey | QZUOGDUIVYXNHN-QCKNELIISA-N |
| XLogP | 5.10 |
| TPSA | 121.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.44 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|