C19H13Cl2N5O2 — CID 166462316
5-[2-amino-5-[(3,5-dichloro-4-pyridinyl)methoxy]benzenecarboximidoyl]-2-oxo-1H-pyridine-3-carbonitrile (PubChem CID 166462316) has the molecular formula C19H13Cl2N5O2 and a molecular weight of 414.25 g/mol. Its IUPAC name is 5-[2-amino-5-[(3,5-dichloro-4-pyridinyl)methoxy]benzenecarboximidoyl]-2-oxo-1H-pyridine-3-carbonitrile.
| Compound Name | 5-[2-amino-5-[(3,5-dichloro-4-pyridinyl)methoxy]benzenecarboximidoyl]-2-oxo-1H-pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 166462316 |
| Molecular Formula | C19H13Cl2N5O2 |
| Molecular Weight | 414.25 g/mol |
| Exact Mass | 413.04 |
| IUPAC Name | 5-[2-amino-5-[(3,5-dichloro-4-pyridinyl)methoxy]benzenecarboximidoyl]-2-oxo-1H-pyridine-3-carbonitrile |
| SMILES | [H]/N=C(\c1c[nH]c(=O)c(C#N)c1)c1cc(OCc2c(Cl)cncc2Cl)ccc1N |
| InChI | InChI=1S/C19H13Cl2N5O2/c20-15-7-25-8-16(21)14(15)9-28-12-1-2-17(23)13(4-12)18(24)11-3-10(5-22)19(27)26-6-11/h1-4,6-8,24H,9,23H2,(H,26,27)/b24-18+ |
| InChIKey | BWSNRZPBMVOXIW-HKOYGPOVSA-N |
| XLogP | 3.53 |
| TPSA | 128.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.25 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|