C19H18Cl2N6O — CID 164565610
2-[1-(azetidin-3-yl)pyrazole-4-carboximidoyl]-4-[(3,5-dichloro-4-pyridinyl)methoxy]aniline (PubChem CID 164565610) has the molecular formula C19H18Cl2N6O and a molecular weight of 417.30 g/mol. Its IUPAC name is 2-[1-(azetidin-3-yl)pyrazole-4-carboximidoyl]-4-[(3,5-dichloro-4-pyridinyl)methoxy]aniline.
| Compound Name | 2-[1-(azetidin-3-yl)pyrazole-4-carboximidoyl]-4-[(3,5-dichloro-4-pyridinyl)methoxy]aniline |
|---|---|
| PubChem CID | 164565610 |
| Molecular Formula | C19H18Cl2N6O |
| Molecular Weight | 417.30 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | 2-[1-(azetidin-3-yl)pyrazole-4-carboximidoyl]-4-[(3,5-dichloro-4-pyridinyl)methoxy]aniline |
| SMILES | [H]/N=C(\c1cnn(C2CNC2)c1)c1cc(OCc2c(Cl)cncc2Cl)ccc1N |
| InChI | InChI=1S/C19H18Cl2N6O/c20-16-7-25-8-17(21)15(16)10-28-13-1-2-18(22)14(3-13)19(23)11-4-26-27(9-11)12-5-24-6-12/h1-4,7-9,12,23-24H,5-6,10,22H2/b23-19+ |
| InChIKey | RIVNXOIACQYOBT-FCDQGJHFSA-N |
| XLogP | 3.31 |
| TPSA | 101.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.30 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|