C26H30Cl2N6O — CID 164566011
2-[1-(1-cyclobutylpiperidin-4-yl)pyrazole-4-carboximidoyl]-4-[(3,5-dichloro-2-methyl-4-pyridinyl)methoxy]aniline (PubChem CID 164566011) has the molecular formula C26H30Cl2N6O and a molecular weight of 513.47 g/mol. Its IUPAC name is 2-[1-(1-cyclobutylpiperidin-4-yl)pyrazole-4-carboximidoyl]-4-[(3,5-dichloro-2-methyl-4-pyridinyl)methoxy]aniline.
| Compound Name | 2-[1-(1-cyclobutylpiperidin-4-yl)pyrazole-4-carboximidoyl]-4-[(3,5-dichloro-2-methyl-4-pyridinyl)methoxy]aniline |
|---|---|
| PubChem CID | 164566011 |
| Molecular Formula | C26H30Cl2N6O |
| Molecular Weight | 513.47 g/mol |
| Exact Mass | 512.19 |
| IUPAC Name | 2-[1-(1-cyclobutylpiperidin-4-yl)pyrazole-4-carboximidoyl]-4-[(3,5-dichloro-2-methyl-4-pyridinyl)methoxy]aniline |
| SMILES | [H]/N=C(\c1cnn(C2CCN(C3CCC3)CC2)c1)c1cc(OCc2c(Cl)cnc(C)c2Cl)ccc1N |
| InChI | InChI=1S/C26H30Cl2N6O/c1-16-25(28)22(23(27)13-31-16)15-35-20-5-6-24(29)21(11-20)26(30)17-12-32-34(14-17)19-7-9-33(10-8-19)18-3-2-4-18/h5-6,11-14,18-19,30H,2-4,7-10,15,29H2,1H3/b30-26+ |
| InChIKey | PARWGGOZAPGNKY-URGPHPNLSA-N |
| XLogP | 5.66 |
| TPSA | 93.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.47 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|