C24H25Cl2N7O2S — CID 164565703
4-[(3,5-dichloro-4-pyridinyl)methoxy]-2-[2-(7-methylsulfinyl-2,7-diazaspiro[3.4]octan-2-yl)pyrimidine-5-carboximidoyl]aniline (PubChem CID 164565703) has the molecular formula C24H25Cl2N7O2S and a molecular weight of 546.48 g/mol. Its IUPAC name is 4-[(3,5-dichloro-4-pyridinyl)methoxy]-2-[2-(7-methylsulfinyl-2,7-diazaspiro[3.4]octan-2-yl)pyrimidine-5-carboximidoyl]aniline.
| Compound Name | 4-[(3,5-dichloro-4-pyridinyl)methoxy]-2-[2-(7-methylsulfinyl-2,7-diazaspiro[3.4]octan-2-yl)pyrimidine-5-carboximidoyl]aniline |
|---|---|
| PubChem CID | 164565703 |
| Molecular Formula | C24H25Cl2N7O2S |
| Molecular Weight | 546.48 g/mol |
| Exact Mass | 545.12 |
| IUPAC Name | 4-[(3,5-dichloro-4-pyridinyl)methoxy]-2-[2-(7-methylsulfinyl-2,7-diazaspiro[3.4]octan-2-yl)pyrimidine-5-carboximidoyl]aniline |
| SMILES | [H]/N=C(/c1cnc(N2CC3(CCN(S(C)=O)C3)C2)nc1)c1cc(OCc2c(Cl)cncc2Cl)ccc1N |
| InChI | InChI=1S/C24H25Cl2N7O2S/c1-36(34)33-5-4-24(14-33)12-32(13-24)23-30-7-15(8-31-23)22(28)17-6-16(2-3-21(17)27)35-11-18-19(25)9-29-10-20(18)26/h2-3,6-10,28H,4-5,11-14,27H2,1H3/b28-22- |
| InChIKey | VAEFLCHEZLLJIM-SLMZUGIISA-N |
| XLogP | 3.56 |
| TPSA | 121.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.48 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|