C28H30Cl2N6O3 — CID 164565870
ethyl 2-[5-[2-amino-5-[(3,5-dichloro-4-pyridinyl)methoxy]benzenecarboximidoyl]-2-pyridinyl]-2,7-diazaspiro[3.5]nonane-7-carboxylate (PubChem CID 164565870) has the molecular formula C28H30Cl2N6O3 and a molecular weight of 569.49 g/mol. Its IUPAC name is ethyl 2-[5-[2-amino-5-[(3,5-dichloro-4-pyridinyl)methoxy]benzenecarboximidoyl]-2-pyridinyl]-2,7-diazaspiro[3.5]nonane-7-carboxylate.
| Compound Name | ethyl 2-[5-[2-amino-5-[(3,5-dichloro-4-pyridinyl)methoxy]benzenecarboximidoyl]-2-pyridinyl]-2,7-diazaspiro[3.5]nonane-7-carboxylate |
|---|---|
| PubChem CID | 164565870 |
| Molecular Formula | C28H30Cl2N6O3 |
| Molecular Weight | 569.49 g/mol |
| Exact Mass | 568.18 |
| IUPAC Name | ethyl 2-[5-[2-amino-5-[(3,5-dichloro-4-pyridinyl)methoxy]benzenecarboximidoyl]-2-pyridinyl]-2,7-diazaspiro[3.5]nonane-7-carboxylate |
| SMILES | [H]/N=C(/c1ccc(N2CC3(CCN(C(=O)OCC)CC3)C2)nc1)c1cc(OCc2c(Cl)cncc2Cl)ccc1N |
| InChI | InChI=1S/C28H30Cl2N6O3/c1-2-38-27(37)35-9-7-28(8-10-35)16-36(17-28)25-6-3-18(12-34-25)26(32)20-11-19(4-5-24(20)31)39-15-21-22(29)13-33-14-23(21)30/h3-6,11-14,32H,2,7-10,15-17,31H2,1H3/b32-26- |
| InChIKey | RVXHYKIJMHBMPH-FSRJSHLRSA-N |
| XLogP | 5.42 |
| TPSA | 117.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.49 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|