C28H33Cl2N7O3 — CID 164566089
4-[(3,5-dichloro-4-pyridinyl)methoxy]-2-[2-(8-methyl-2,8-diazaspiro[3.5]nonan-2-yl)pyrimidine-5-carboximidoyl]aniline;ethyl formate (PubChem CID 164566089) has the molecular formula C28H33Cl2N7O3 and a molecular weight of 586.52 g/mol. Its IUPAC name is 4-[(3,5-dichloro-4-pyridinyl)methoxy]-2-[2-(8-methyl-2,8-diazaspiro[3.5]nonan-2-yl)pyrimidine-5-carboximidoyl]aniline;ethyl formate.
| Compound Name | 4-[(3,5-dichloro-4-pyridinyl)methoxy]-2-[2-(8-methyl-2,8-diazaspiro[3.5]nonan-2-yl)pyrimidine-5-carboximidoyl]aniline;ethyl formate |
|---|---|
| PubChem CID | 164566089 |
| Molecular Formula | C28H33Cl2N7O3 |
| Molecular Weight | 586.52 g/mol |
| Exact Mass | 585.20 |
| IUPAC Name | 4-[(3,5-dichloro-4-pyridinyl)methoxy]-2-[2-(8-methyl-2,8-diazaspiro[3.5]nonan-2-yl)pyrimidine-5-carboximidoyl]aniline;ethyl formate |
| SMILES | CCOC=O.[H]/N=C(/c1cnc(N2CC3(CCCN(C)C3)C2)nc1)c1cc(OCc2c(Cl)cncc2Cl)ccc1N |
| InChI | InChI=1S/C25H27Cl2N7O.C3H6O2/c1-33-6-2-5-25(13-33)14-34(15-25)24-31-8-16(9-32-24)23(29)18-7-17(3-4-22(18)28)35-12-19-20(26)10-30-11-21(19)27;1-2-5-3-4/h3-4,7-11,29H,2,5-6,12-15,28H2,1H3;3H,2H2,1H3/b29-23-; |
| InChIKey | SUYIUEIVAKRZIC-MBANDDHJSA-N |
| XLogP | 4.47 |
| TPSA | 130.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.52 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|