C24H24Cl2N6O2S — CID 164566104
4-[(3,5-dichloro-4-pyridinyl)methoxy]-2-[2-(6-oxo-6λ4-thia-2-azaspiro[3.5]nonan-2-yl)pyrimidine-5-carboximidoyl]aniline (PubChem CID 164566104) has the molecular formula C24H24Cl2N6O2S and a molecular weight of 531.47 g/mol. Its IUPAC name is 4-[(3,5-dichloro-4-pyridinyl)methoxy]-2-[2-(6-oxo-6λ4-thia-2-azaspiro[3.5]nonan-2-yl)pyrimidine-5-carboximidoyl]aniline.
| Compound Name | 4-[(3,5-dichloro-4-pyridinyl)methoxy]-2-[2-(6-oxo-6λ4-thia-2-azaspiro[3.5]nonan-2-yl)pyrimidine-5-carboximidoyl]aniline |
|---|---|
| PubChem CID | 164566104 |
| Molecular Formula | C24H24Cl2N6O2S |
| Molecular Weight | 531.47 g/mol |
| Exact Mass | 530.11 |
| IUPAC Name | 4-[(3,5-dichloro-4-pyridinyl)methoxy]-2-[2-(6-oxo-6λ4-thia-2-azaspiro[3.5]nonan-2-yl)pyrimidine-5-carboximidoyl]aniline |
| SMILES | [H]/N=C(/c1cnc(N2CC3(CCCS(=O)C3)C2)nc1)c1cc(OCc2c(Cl)cncc2Cl)ccc1N |
| InChI | InChI=1S/C24H24Cl2N6O2S/c25-19-9-29-10-20(26)18(19)11-34-16-2-3-21(27)17(6-16)22(28)15-7-30-23(31-8-15)32-12-24(13-32)4-1-5-35(33)14-24/h2-3,6-10,28H,1,4-5,11-14,27H2/b28-22- |
| InChIKey | LVNLLAAISRHAQG-SLMZUGIISA-N |
| XLogP | 4.10 |
| TPSA | 118.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.47 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|