C23H22Cl2N6O2 — CID 164565855
4-[5-[2-amino-5-[(3,5-dichloro-4-pyridinyl)methoxy]benzenecarboximidoyl]-2-pyridinyl]-1,4-diazepan-2-one (PubChem CID 164565855) has the molecular formula C23H22Cl2N6O2 and a molecular weight of 485.38 g/mol. Its IUPAC name is 4-[5-[2-amino-5-[(3,5-dichloro-4-pyridinyl)methoxy]benzenecarboximidoyl]-2-pyridinyl]-1,4-diazepan-2-one.
| Compound Name | 4-[5-[2-amino-5-[(3,5-dichloro-4-pyridinyl)methoxy]benzenecarboximidoyl]-2-pyridinyl]-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 164565855 |
| Molecular Formula | C23H22Cl2N6O2 |
| Molecular Weight | 485.38 g/mol |
| Exact Mass | 484.12 |
| IUPAC Name | 4-[5-[2-amino-5-[(3,5-dichloro-4-pyridinyl)methoxy]benzenecarboximidoyl]-2-pyridinyl]-1,4-diazepan-2-one |
| SMILES | [H]/N=C(\c1ccc(N2CCCNC(=O)C2)nc1)c1cc(OCc2c(Cl)cncc2Cl)ccc1N |
| InChI | InChI=1S/C23H22Cl2N6O2/c24-18-10-28-11-19(25)17(18)13-33-15-3-4-20(26)16(8-15)23(27)14-2-5-21(30-9-14)31-7-1-6-29-22(32)12-31/h2-5,8-11,27H,1,6-7,12-13,26H2,(H,29,32)/b27-23+ |
| InChIKey | NSHCXURNDRMQST-SLEBQGDGSA-N |
| XLogP | 3.69 |
| TPSA | 117.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.38 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|