C26H24Cl2N4O3 — CID 166462441
6-[2-amino-5-[(3,5-dichloro-4-pyridinyl)methoxy]benzenecarboximidoyl]spiro[3H-chromene-2,4'-piperidine]-4-one (PubChem CID 166462441) has the molecular formula C26H24Cl2N4O3 and a molecular weight of 511.41 g/mol. Its IUPAC name is 6-[2-amino-5-[(3,5-dichloro-4-pyridinyl)methoxy]benzenecarboximidoyl]spiro[3H-chromene-2,4'-piperidine]-4-one.
| Compound Name | 6-[2-amino-5-[(3,5-dichloro-4-pyridinyl)methoxy]benzenecarboximidoyl]spiro[3H-chromene-2,4'-piperidine]-4-one |
|---|---|
| PubChem CID | 166462441 |
| Molecular Formula | C26H24Cl2N4O3 |
| Molecular Weight | 511.41 g/mol |
| Exact Mass | 510.12 |
| IUPAC Name | 6-[2-amino-5-[(3,5-dichloro-4-pyridinyl)methoxy]benzenecarboximidoyl]spiro[3H-chromene-2,4'-piperidine]-4-one |
| SMILES | [H]/N=C(\c1ccc2c(c1)C(=O)CC1(CCNCC1)O2)c1cc(OCc2c(Cl)cncc2Cl)ccc1N |
| InChI | InChI=1S/C26H24Cl2N4O3/c27-20-12-32-13-21(28)19(20)14-34-16-2-3-22(29)17(10-16)25(30)15-1-4-24-18(9-15)23(33)11-26(35-24)5-7-31-8-6-26/h1-4,9-10,12-13,30-31H,5-8,11,14,29H2/b30-25+ |
| InChIKey | IWTVUKFOENWXQN-QCWLDUFUSA-N |
| XLogP | 5.05 |
| TPSA | 110.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.41 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|