C25H26Cl2N6O — CID 164565862
4-[(3,5-dichloro-4-pyridinyl)methoxy]-2-[6-(4-methyl-4,7-diazaspiro[2.5]octan-7-yl)pyridine-3-carboximidoyl]aniline (PubChem CID 164565862) has the molecular formula C25H26Cl2N6O and a molecular weight of 497.43 g/mol. Its IUPAC name is 4-[(3,5-dichloro-4-pyridinyl)methoxy]-2-[6-(4-methyl-4,7-diazaspiro[2.5]octan-7-yl)pyridine-3-carboximidoyl]aniline.
| Compound Name | 4-[(3,5-dichloro-4-pyridinyl)methoxy]-2-[6-(4-methyl-4,7-diazaspiro[2.5]octan-7-yl)pyridine-3-carboximidoyl]aniline |
|---|---|
| PubChem CID | 164565862 |
| Molecular Formula | C25H26Cl2N6O |
| Molecular Weight | 497.43 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | 4-[(3,5-dichloro-4-pyridinyl)methoxy]-2-[6-(4-methyl-4,7-diazaspiro[2.5]octan-7-yl)pyridine-3-carboximidoyl]aniline |
| SMILES | [H]/N=C(/c1ccc(N2CCN(C)C3(CC3)C2)nc1)c1cc(OCc2c(Cl)cncc2Cl)ccc1N |
| InChI | InChI=1S/C25H26Cl2N6O/c1-32-8-9-33(15-25(32)6-7-25)23-5-2-16(11-31-23)24(29)18-10-17(3-4-22(18)28)34-14-19-20(26)12-30-13-21(19)27/h2-5,10-13,29H,6-9,14-15,28H2,1H3/b29-24- |
| InChIKey | NJMDZEXGOFPGIO-OLFWJLLRSA-N |
| XLogP | 4.65 |
| TPSA | 91.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.43 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|