C23H23Cl2N5O — CID 164565902
4-[(3,5-dichloro-2-methyl-4-pyridinyl)methoxy]-2-(6-pyrrolidin-1-ylpyridine-3-carboximidoyl)aniline (PubChem CID 164565902) has the molecular formula C23H23Cl2N5O and a molecular weight of 456.38 g/mol. Its IUPAC name is 4-[(3,5-dichloro-2-methyl-4-pyridinyl)methoxy]-2-(6-pyrrolidin-1-ylpyridine-3-carboximidoyl)aniline.
| Compound Name | 4-[(3,5-dichloro-2-methyl-4-pyridinyl)methoxy]-2-(6-pyrrolidin-1-ylpyridine-3-carboximidoyl)aniline |
|---|---|
| PubChem CID | 164565902 |
| Molecular Formula | C23H23Cl2N5O |
| Molecular Weight | 456.38 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | 4-[(3,5-dichloro-2-methyl-4-pyridinyl)methoxy]-2-(6-pyrrolidin-1-ylpyridine-3-carboximidoyl)aniline |
| SMILES | [H]/N=C(\c1ccc(N2CCCC2)nc1)c1cc(OCc2c(Cl)cnc(C)c2Cl)ccc1N |
| InChI | InChI=1S/C23H23Cl2N5O/c1-14-22(25)18(19(24)12-28-14)13-31-16-5-6-20(26)17(10-16)23(27)15-4-7-21(29-11-15)30-8-2-3-9-30/h4-7,10-12,27H,2-3,8-9,13,26H2,1H3/b27-23+ |
| InChIKey | IKPUGDWRWHGULK-SLEBQGDGSA-N |
| XLogP | 5.27 |
| TPSA | 88.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.38 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|