C23H20Cl2N6O — CID 164566012
5-[2-amino-5-[(3,5-dichloro-2-methyl-4-pyridinyl)methoxy]benzenecarboximidoyl]-2-(azetidin-1-yl)pyridine-3-carbonitrile (PubChem CID 164566012) has the molecular formula C23H20Cl2N6O and a molecular weight of 467.36 g/mol. Its IUPAC name is 5-[2-amino-5-[(3,5-dichloro-2-methyl-4-pyridinyl)methoxy]benzenecarboximidoyl]-2-(azetidin-1-yl)pyridine-3-carbonitrile.
| Compound Name | 5-[2-amino-5-[(3,5-dichloro-2-methyl-4-pyridinyl)methoxy]benzenecarboximidoyl]-2-(azetidin-1-yl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 164566012 |
| Molecular Formula | C23H20Cl2N6O |
| Molecular Weight | 467.36 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | 5-[2-amino-5-[(3,5-dichloro-2-methyl-4-pyridinyl)methoxy]benzenecarboximidoyl]-2-(azetidin-1-yl)pyridine-3-carbonitrile |
| SMILES | [H]/N=C(\c1cnc(N2CCC2)c(C#N)c1)c1cc(OCc2c(Cl)cnc(C)c2Cl)ccc1N |
| InChI | InChI=1S/C23H20Cl2N6O/c1-13-21(25)18(19(24)11-29-13)12-32-16-3-4-20(27)17(8-16)22(28)15-7-14(9-26)23(30-10-15)31-5-2-6-31/h3-4,7-8,10-11,28H,2,5-6,12,27H2,1H3/b28-22+ |
| InChIKey | NCJFVNNIXAWVEN-XAYXJRQQSA-N |
| XLogP | 4.75 |
| TPSA | 111.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.36 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|