C28H30Cl2N4O4 — CID 167290986
4-[(3,5-dichloro-4-pyridinyl)methoxy]-2-(1'-ethylspiro[4H-1,3-benzodioxine-2,4'-piperidine]-6-carboximidoyl)-5-methoxyaniline (PubChem CID 167290986) has the molecular formula C28H30Cl2N4O4 and a molecular weight of 557.48 g/mol. Its IUPAC name is 4-[(3,5-dichloro-4-pyridinyl)methoxy]-2-(1'-ethylspiro[4H-1,3-benzodioxine-2,4'-piperidine]-6-carboximidoyl)-5-methoxyaniline.
| Compound Name | 4-[(3,5-dichloro-4-pyridinyl)methoxy]-2-(1'-ethylspiro[4H-1,3-benzodioxine-2,4'-piperidine]-6-carboximidoyl)-5-methoxyaniline |
|---|---|
| PubChem CID | 167290986 |
| Molecular Formula | C28H30Cl2N4O4 |
| Molecular Weight | 557.48 g/mol |
| Exact Mass | 556.16 |
| IUPAC Name | 4-[(3,5-dichloro-4-pyridinyl)methoxy]-2-(1'-ethylspiro[4H-1,3-benzodioxine-2,4'-piperidine]-6-carboximidoyl)-5-methoxyaniline |
| SMILES | [H]/N=C(\c1ccc2c(c1)COC1(CCN(CC)CC1)O2)c1cc(OCc2c(Cl)cncc2Cl)c(OC)cc1N |
| InChI | InChI=1S/C28H30Cl2N4O4/c1-3-34-8-6-28(7-9-34)37-15-18-10-17(4-5-24(18)38-28)27(32)19-11-26(25(35-2)12-23(19)31)36-16-20-21(29)13-33-14-22(20)30/h4-5,10-14,32H,3,6-9,15-16,31H2,1-2H3/b32-27+ |
| InChIKey | ASFRBXRLYHNVHH-QVAGMWBUSA-N |
| XLogP | 5.70 |
| TPSA | 102.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.48 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|