C22H22F2N4O3S — CID 164565657
4-[(3,5-difluorophenyl)methoxy]-2-[1-(1,1-dioxothian-4-yl)pyrazole-4-carboximidoyl]aniline (PubChem CID 164565657) has the molecular formula C22H22F2N4O3S and a molecular weight of 460.51 g/mol. Its IUPAC name is 4-[(3,5-difluorophenyl)methoxy]-2-[1-(1,1-dioxothian-4-yl)pyrazole-4-carboximidoyl]aniline.
| Compound Name | 4-[(3,5-difluorophenyl)methoxy]-2-[1-(1,1-dioxothian-4-yl)pyrazole-4-carboximidoyl]aniline |
|---|---|
| PubChem CID | 164565657 |
| Molecular Formula | C22H22F2N4O3S |
| Molecular Weight | 460.51 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | 4-[(3,5-difluorophenyl)methoxy]-2-[1-(1,1-dioxothian-4-yl)pyrazole-4-carboximidoyl]aniline |
| SMILES | [H]/N=C(\c1cnn(C2CCS(=O)(=O)CC2)c1)c1cc(OCc2cc(F)cc(F)c2)ccc1N |
| InChI | InChI=1S/C22H22F2N4O3S/c23-16-7-14(8-17(24)9-16)13-31-19-1-2-21(25)20(10-19)22(26)15-11-27-28(12-15)18-3-5-32(29,30)6-4-18/h1-2,7-12,18,26H,3-6,13,25H2/b26-22+ |
| InChIKey | MHXBBKKVIPBXGJ-XTCLZLMSSA-N |
| XLogP | 3.49 |
| TPSA | 111.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.51 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|