C20H23FN6 — CID 142112733
2-(4-fluorobenzenecarboximidoyl)-4-[3-(pyrrolidin-1-ylmethyl)-2,3-dihydro-1H-1,2,4-triazol-5-yl]aniline (PubChem CID 142112733) has the molecular formula C20H23FN6 and a molecular weight of 366.44 g/mol. Its IUPAC name is 2-(4-fluorobenzenecarboximidoyl)-4-[3-(pyrrolidin-1-ylmethyl)-2,3-dihydro-1H-1,2,4-triazol-5-yl]aniline.
| Compound Name | 2-(4-fluorobenzenecarboximidoyl)-4-[3-(pyrrolidin-1-ylmethyl)-2,3-dihydro-1H-1,2,4-triazol-5-yl]aniline |
|---|---|
| PubChem CID | 142112733 |
| Molecular Formula | C20H23FN6 |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | 2-(4-fluorobenzenecarboximidoyl)-4-[3-(pyrrolidin-1-ylmethyl)-2,3-dihydro-1H-1,2,4-triazol-5-yl]aniline |
| SMILES | [H]/N=C(\c1ccc(F)cc1)c1cc(C2=NC(CN3CCCC3)NN2)ccc1N |
| InChI | InChI=1S/C20H23FN6/c21-15-6-3-13(4-7-15)19(23)16-11-14(5-8-17(16)22)20-24-18(25-26-20)12-27-9-1-2-10-27/h3-8,11,18,23,25H,1-2,9-10,12,22H2,(H,24,26)/b23-19+ |
| InChIKey | BJGTXPDZYLYYCA-FCDQGJHFSA-N |
| XLogP | 2.10 |
| TPSA | 89.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|