C22H29N7O2 — CID 156866779
4-nitro-2-[2-[4-(piperidin-4-ylmethyl)piperazin-1-yl]pyridine-4-carboximidoyl]aniline (PubChem CID 156866779) has the molecular formula C22H29N7O2 and a molecular weight of 423.52 g/mol. Its IUPAC name is 4-nitro-2-[2-[4-(piperidin-4-ylmethyl)piperazin-1-yl]pyridine-4-carboximidoyl]aniline.
| Compound Name | 4-nitro-2-[2-[4-(piperidin-4-ylmethyl)piperazin-1-yl]pyridine-4-carboximidoyl]aniline |
|---|---|
| PubChem CID | 156866779 |
| Molecular Formula | C22H29N7O2 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | 4-nitro-2-[2-[4-(piperidin-4-ylmethyl)piperazin-1-yl]pyridine-4-carboximidoyl]aniline |
| SMILES | [H]/N=C(\c1ccnc(N2CCN(CC3CCNCC3)CC2)c1)c1cc([N+](=O)[O-])ccc1N |
| InChI | InChI=1S/C22H29N7O2/c23-20-2-1-18(29(30)31)14-19(20)22(24)17-5-8-26-21(13-17)28-11-9-27(10-12-28)15-16-3-6-25-7-4-16/h1-2,5,8,13-14,16,24-25H,3-4,6-7,9-12,15,23H2/b24-22+ |
| InChIKey | JMOBCNQVHUAZAB-ZNTNEXAZSA-N |
| XLogP | 2.11 |
| TPSA | 124.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|