C24H28N6O2 — CID 173481026
N-[2-(methylamino)-5-phenylmethoxybenzenecarboximidoyl]-1-piperidin-4-ylpyrazole-4-carboxamide (PubChem CID 173481026) has the molecular formula C24H28N6O2 and a molecular weight of 432.53 g/mol. Its IUPAC name is N-[2-(methylamino)-5-phenylmethoxybenzenecarboximidoyl]-1-piperidin-4-ylpyrazole-4-carboxamide.
| Compound Name | N-[2-(methylamino)-5-phenylmethoxybenzenecarboximidoyl]-1-piperidin-4-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 173481026 |
| Molecular Formula | C24H28N6O2 |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | N-[2-(methylamino)-5-phenylmethoxybenzenecarboximidoyl]-1-piperidin-4-ylpyrazole-4-carboxamide |
| SMILES | [H]/N=C(\NC(=O)c1cnn(C2CCNCC2)c1)c1cc(OCc2ccccc2)ccc1NC |
| InChI | InChI=1S/C24H28N6O2/c1-26-22-8-7-20(32-16-17-5-3-2-4-6-17)13-21(22)23(25)29-24(31)18-14-28-30(15-18)19-9-11-27-12-10-19/h2-8,13-15,19,26-27H,9-12,16H2,1H3,(H2,25,29,31) |
| InChIKey | GKQCLXAAMNJBGR-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|