C22H30N2O3 — CID 143063494
tert-butyl N-(2-ethanimidoyl-4-phenylmethoxyphenyl)carbamate;ethane (PubChem CID 143063494) has the molecular formula C22H30N2O3 and a molecular weight of 370.49 g/mol. Its IUPAC name is tert-butyl N-(2-ethanimidoyl-4-phenylmethoxyphenyl)carbamate;ethane.
| Compound Name | tert-butyl N-(2-ethanimidoyl-4-phenylmethoxyphenyl)carbamate;ethane |
|---|---|
| PubChem CID | 143063494 |
| Molecular Formula | C22H30N2O3 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.23 |
| IUPAC Name | tert-butyl N-(2-ethanimidoyl-4-phenylmethoxyphenyl)carbamate;ethane |
| SMILES | CC.[H]/N=C(\C)c1cc(OCc2ccccc2)ccc1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H24N2O3.C2H6/c1-14(21)17-12-16(24-13-15-8-6-5-7-9-15)10-11-18(17)22-19(23)25-20(2,3)4;1-2/h5-12,21H,13H2,1-4H3,(H,22,23);1-2H3/b21-14+; |
| InChIKey | WFGPBUOAYRVXSZ-UNLLECTCSA-N |
| XLogP | 6.03 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|