C23H26N4O3 — CID 156851099
tert-butyl N-[4-[(2-cyano-5,6,7,8-tetrahydroquinolin-5-yl)oxy]-2-ethanimidoylphenyl]carbamate (PubChem CID 156851099) has the molecular formula C23H26N4O3 and a molecular weight of 406.49 g/mol. Its IUPAC name is tert-butyl N-[4-[(2-cyano-5,6,7,8-tetrahydroquinolin-5-yl)oxy]-2-ethanimidoylphenyl]carbamate.
| Compound Name | tert-butyl N-[4-[(2-cyano-5,6,7,8-tetrahydroquinolin-5-yl)oxy]-2-ethanimidoylphenyl]carbamate |
|---|---|
| PubChem CID | 156851099 |
| Molecular Formula | C23H26N4O3 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | tert-butyl N-[4-[(2-cyano-5,6,7,8-tetrahydroquinolin-5-yl)oxy]-2-ethanimidoylphenyl]carbamate |
| SMILES | [H]/N=C(\C)c1cc(OC2CCCc3nc(C#N)ccc32)ccc1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H26N4O3/c1-14(25)18-12-16(9-11-20(18)27-22(28)30-23(2,3)4)29-21-7-5-6-19-17(21)10-8-15(13-24)26-19/h8-12,21,25H,5-7H2,1-4H3,(H,27,28)/b25-14+ |
| InChIKey | GRFDZQPBIHIWIP-AFUMVMLFSA-N |
| XLogP | 5.14 |
| TPSA | 108.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|