C17H23N3O4Si — CID 23571040
tert-butyl N-[4-nitro-2-(3-trimethylsilylprop-2-ynimidoyl)phenyl]carbamate (PubChem CID 23571040) has the molecular formula C17H23N3O4Si and a molecular weight of 361.47 g/mol. Its IUPAC name is tert-butyl N-[4-nitro-2-(3-trimethylsilylprop-2-ynimidoyl)phenyl]carbamate.
| Compound Name | tert-butyl N-[4-nitro-2-(3-trimethylsilylprop-2-ynimidoyl)phenyl]carbamate |
|---|---|
| PubChem CID | 23571040 |
| Molecular Formula | C17H23N3O4Si |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | tert-butyl N-[4-nitro-2-(3-trimethylsilylprop-2-ynimidoyl)phenyl]carbamate |
| SMILES | [H]/N=C(\C#C[Si](C)(C)C)c1cc([N+](=O)[O-])ccc1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H23N3O4Si/c1-17(2,3)24-16(21)19-15-8-7-12(20(22)23)11-13(15)14(18)9-10-25(4,5)6/h7-8,11,18H,1-6H3,(H,19,21)/b18-14+ |
| InChIKey | ZNOSGAQYLJVYPH-NBVRZTHBSA-N |
| XLogP | 4.19 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|