C19H30N2O2 — CID 107240302
tert-butyl N-[2-(2-cyclohexylethylamino)phenyl]carbamate (PubChem CID 107240302) has the molecular formula C19H30N2O2 and a molecular weight of 318.46 g/mol. Its IUPAC name is tert-butyl N-[2-(2-cyclohexylethylamino)phenyl]carbamate.
| Compound Name | tert-butyl N-[2-(2-cyclohexylethylamino)phenyl]carbamate |
|---|---|
| PubChem CID | 107240302 |
| Molecular Formula | C19H30N2O2 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.23 |
| IUPAC Name | tert-butyl N-[2-(2-cyclohexylethylamino)phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccccc1NCCC1CCCCC1 |
| InChI | InChI=1S/C19H30N2O2/c1-19(2,3)23-18(22)21-17-12-8-7-11-16(17)20-14-13-15-9-5-4-6-10-15/h7-8,11-12,15,20H,4-6,9-10,13-14H2,1-3H3,(H,21,22) |
| InChIKey | UDTJYWNURORCSR-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |