tert-butyl N-[2-(3-ethylsulfanylpropylamino)phenyl]carbamate

C16H26N2O2S — CID 107240372

IUPACtert-butyl N-[2-(3-ethylsulfanylpropylamino)phenyl]carbamate
SMILESCCSCCCNc1ccccc1NC(=O)OC(C)(C)C
InChIInChI=1S/C16H26N2O2S/c1-5-21-12-8-11-17-13-9-6-7-10-14(13)18-15(19)20-16(2,3)4/h6-7,9-10,17H,5,8,11-12H2,1-4H3,(H,18,19)
InChIKeyVPSYUVNHSUDCKQ-UHFFFAOYSA-N
MW310.46 g/mol
LogP4.59
Rot. Bonds7

About tert-butyl N-[2-(3-ethylsulfanylpropylamino)phenyl]carbamate

tert-butyl N-[2-(3-ethylsulfanylpropylamino)phenyl]carbamate (PubChem CID 107240372) has the molecular formula C16H26N2O2S and a molecular weight of 310.46 g/mol. Its IUPAC name is tert-butyl N-[2-(3-ethylsulfanylpropylamino)phenyl]carbamate.

Molecular Properties

Compound Nametert-butyl N-[2-(3-ethylsulfanylpropylamino)phenyl]carbamate
PubChem CID107240372
Molecular FormulaC16H26N2O2S
Molecular Weight310.46 g/mol
Exact Mass310.17
IUPAC Nametert-butyl N-[2-(3-ethylsulfanylpropylamino)phenyl]carbamate
SMILESCCSCCCNc1ccccc1NC(=O)OC(C)(C)C
InChIInChI=1S/C16H26N2O2S/c1-5-21-12-8-11-17-13-9-6-7-10-14(13)18-15(19)20-16(2,3)4/h6-7,9-10,17H,5,8,11-12H2,1-4H3,(H,18,19)
InChIKeyVPSYUVNHSUDCKQ-UHFFFAOYSA-N
XLogP4.59
TPSA50.36 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500310.46
LogP ≤ 54.59
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze tert-butyl N-[2-(3-ethylsulfanylpropylamino)phenyl]carbamate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of tert-butyl N-[2-(3-ethylsulfanylpropylamino)phenyl]carbamate?
The IUPAC name of tert-butyl N-[2-(3-ethylsulfanylpropylamino)phenyl]carbamate (CID 107240372) is tert-butyl N-[2-(3-ethylsulfanylpropylamino)phenyl]carbamate.
What is the SMILES notation for tert-butyl N-[2-(3-ethylsulfanylpropylamino)phenyl]carbamate?
The canonical SMILES for tert-butyl N-[2-(3-ethylsulfanylpropylamino)phenyl]carbamate is CCSCCCNc1ccccc1NC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl N-[2-(3-ethylsulfanylpropylamino)phenyl]carbamate?
The InChIKey is VPSYUVNHSUDCKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N2O2S/c1-5-21-12-8-11-17-13-9-6-7-10-14(13)18-15(19)20-16(2,3)4/h6-7,9-10,17H,5,8,11-12H2,1-4H3,(H,18,19).
What are the key properties of tert-butyl N-[2-(3-ethylsulfanylpropylamino)phenyl]carbamate?
tert-butyl N-[2-(3-ethylsulfanylpropylamino)phenyl]carbamate has a molecular weight of 310.46 g/mol, XLogP of 4.59, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[2-(3-ethylsulfanylpropylamino)phenyl]carbamate is sourced from PubChem (CID 107240372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).