C22H21IN4O3 — CID 166727870
tert-butyl 5-[(2-cyano-5,6,7,8-tetrahydroquinolin-5-yl)oxy]-3-iodoindazole-1-carboxylate (PubChem CID 166727870) has the molecular formula C22H21IN4O3 and a molecular weight of 516.34 g/mol. Its IUPAC name is tert-butyl 5-[(2-cyano-5,6,7,8-tetrahydroquinolin-5-yl)oxy]-3-iodoindazole-1-carboxylate.
| Compound Name | tert-butyl 5-[(2-cyano-5,6,7,8-tetrahydroquinolin-5-yl)oxy]-3-iodoindazole-1-carboxylate |
|---|---|
| PubChem CID | 166727870 |
| Molecular Formula | C22H21IN4O3 |
| Molecular Weight | 516.34 g/mol |
| Exact Mass | 516.07 |
| IUPAC Name | tert-butyl 5-[(2-cyano-5,6,7,8-tetrahydroquinolin-5-yl)oxy]-3-iodoindazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1nc(I)c2cc(OC3CCCc4nc(C#N)ccc43)ccc21 |
| InChI | InChI=1S/C22H21IN4O3/c1-22(2,3)30-21(28)27-18-10-8-14(11-16(18)20(23)26-27)29-19-6-4-5-17-15(19)9-7-13(12-24)25-17/h7-11,19H,4-6H2,1-3H3 |
| InChIKey | NUJCXNWABBVGFP-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 90.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.34 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|