C15H19N3O2S — CID 139301046
[2-cyano-6-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl] propanimidothioate (PubChem CID 139301046) has the molecular formula C15H19N3O2S and a molecular weight of 305.40 g/mol. Its IUPAC name is [2-cyano-6-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl] propanimidothioate.
| Compound Name | [2-cyano-6-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl] propanimidothioate |
|---|---|
| PubChem CID | 139301046 |
| Molecular Formula | C15H19N3O2S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | [2-cyano-6-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl] propanimidothioate |
| SMILES | [H]/N=C(\CC)Sc1c(C#N)cccc1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H19N3O2S/c1-5-12(17)21-13-10(9-16)7-6-8-11(13)18-14(19)20-15(2,3)4/h6-8,17H,5H2,1-4H3,(H,18,19)/b17-12+ |
| InChIKey | KCPLDKQIBJXMBK-SFQUDFHCSA-N |
| XLogP | 4.38 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|