C14H20BNO6 — CID 67270338
[3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-propanoyloxyphenyl]boronic acid (PubChem CID 67270338) has the molecular formula C14H20BNO6 and a molecular weight of 309.13 g/mol. Its IUPAC name is [3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-propanoyloxyphenyl]boronic acid.
| Compound Name | [3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-propanoyloxyphenyl]boronic acid |
|---|---|
| PubChem CID | 67270338 |
| Molecular Formula | C14H20BNO6 |
| Molecular Weight | 309.13 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | [3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-propanoyloxyphenyl]boronic acid |
| SMILES | CCC(=O)Oc1c(NC(=O)OC(C)(C)C)cccc1B(O)O |
| InChI | InChI=1S/C14H20BNO6/c1-5-11(17)21-12-9(15(19)20)7-6-8-10(12)16-13(18)22-14(2,3)4/h6-8,19-20H,5H2,1-4H3,(H,16,18) |
| InChIKey | XECVLECGLLBWNM-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.13 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|