C20H23NO5 — CID 175485903
[2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-phenoxyphenyl] propanoate (PubChem CID 175485903) has the molecular formula C20H23NO5 and a molecular weight of 357.41 g/mol. Its IUPAC name is [2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-phenoxyphenyl] propanoate.
| Compound Name | [2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-phenoxyphenyl] propanoate |
|---|---|
| PubChem CID | 175485903 |
| Molecular Formula | C20H23NO5 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | [2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-phenoxyphenyl] propanoate |
| SMILES | CCC(=O)Oc1c(NC(=O)OC(C)(C)C)cccc1Oc1ccccc1 |
| InChI | InChI=1S/C20H23NO5/c1-5-17(22)25-18-15(21-19(23)26-20(2,3)4)12-9-13-16(18)24-14-10-7-6-8-11-14/h6-13H,5H2,1-4H3,(H,21,23) |
| InChIKey | SXOQIMZKVZZSNW-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|