C21H26N2O5 — CID 69163314
[2-(4-aminophenoxy)-6-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl] butanoate (PubChem CID 69163314) has the molecular formula C21H26N2O5 and a molecular weight of 386.45 g/mol. Its IUPAC name is [2-(4-aminophenoxy)-6-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl] butanoate.
| Compound Name | [2-(4-aminophenoxy)-6-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl] butanoate |
|---|---|
| PubChem CID | 69163314 |
| Molecular Formula | C21H26N2O5 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | [2-(4-aminophenoxy)-6-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl] butanoate |
| SMILES | CCCC(=O)Oc1c(NC(=O)OC(C)(C)C)cccc1Oc1ccc(N)cc1 |
| InChI | InChI=1S/C21H26N2O5/c1-5-7-18(24)27-19-16(23-20(25)28-21(2,3)4)8-6-9-17(19)26-15-12-10-14(22)11-13-15/h6,8-13H,5,7,22H2,1-4H3,(H,23,25) |
| InChIKey | SAGSSDWHVXUTBJ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|