C24H33NO5 — CID 156725209
ethane;ethyl 2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylmethoxyphenyl]acetate (PubChem CID 156725209) has the molecular formula C24H33NO5 and a molecular weight of 415.53 g/mol. Its IUPAC name is ethane;ethyl 2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylmethoxyphenyl]acetate.
| Compound Name | ethane;ethyl 2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylmethoxyphenyl]acetate |
|---|---|
| PubChem CID | 156725209 |
| Molecular Formula | C24H33NO5 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.24 |
| IUPAC Name | ethane;ethyl 2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylmethoxyphenyl]acetate |
| SMILES | CC.CCOC(=O)Cc1cccc(NC(=O)OC(C)(C)C)c1OCc1ccccc1 |
| InChI | InChI=1S/C22H27NO5.C2H6/c1-5-26-19(24)14-17-12-9-13-18(23-21(25)28-22(2,3)4)20(17)27-15-16-10-7-6-8-11-16;1-2/h6-13H,5,14-15H2,1-4H3,(H,23,25);1-2H3 |
| InChIKey | RGXAGFZIGORBEI-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |