C17H21NO4 — CID 134943764
ethyl 4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]but-3-ynoate (PubChem CID 134943764) has the molecular formula C17H21NO4 and a molecular weight of 303.36 g/mol. Its IUPAC name is ethyl 4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]but-3-ynoate.
| Compound Name | ethyl 4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]but-3-ynoate |
|---|---|
| PubChem CID | 134943764 |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | ethyl 4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]but-3-ynoate |
| SMILES | CCOC(=O)CC#Cc1ccccc1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H21NO4/c1-5-21-15(19)12-8-10-13-9-6-7-11-14(13)18-16(20)22-17(2,3)4/h6-7,9,11H,5,12H2,1-4H3,(H,18,20) |
| InChIKey | PVXNEYXYCHMLSI-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|