C25H37N3O6 — CID 175395616
[2-[4-(4-methoxycyclohexyl)-2-oxopiperazin-1-yl]-6-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl] propanoate (PubChem CID 175395616) has the molecular formula C25H37N3O6 and a molecular weight of 475.59 g/mol. Its IUPAC name is [2-[4-(4-methoxycyclohexyl)-2-oxopiperazin-1-yl]-6-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl] propanoate.
| Compound Name | [2-[4-(4-methoxycyclohexyl)-2-oxopiperazin-1-yl]-6-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl] propanoate |
|---|---|
| PubChem CID | 175395616 |
| Molecular Formula | C25H37N3O6 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.27 |
| IUPAC Name | [2-[4-(4-methoxycyclohexyl)-2-oxopiperazin-1-yl]-6-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl] propanoate |
| SMILES | CCC(=O)Oc1c(NC(=O)OC(C)(C)C)cccc1N1CCN(C2CCC(OC)CC2)CC1=O |
| InChI | InChI=1S/C25H37N3O6/c1-6-22(30)33-23-19(26-24(31)34-25(2,3)4)8-7-9-20(23)28-15-14-27(16-21(28)29)17-10-12-18(32-5)13-11-17/h7-9,17-18H,6,10-16H2,1-5H3,(H,26,31) |
| InChIKey | FZQOIMHTDIPKOQ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|