C19H29NO4 — CID 67684676
tert-butyl N-[2-(2-cyclopentyl-2-hydroxyethyl)-4-methoxyphenyl]carbamate (PubChem CID 67684676) has the molecular formula C19H29NO4 and a molecular weight of 335.44 g/mol. Its IUPAC name is tert-butyl N-[2-(2-cyclopentyl-2-hydroxyethyl)-4-methoxyphenyl]carbamate.
| Compound Name | tert-butyl N-[2-(2-cyclopentyl-2-hydroxyethyl)-4-methoxyphenyl]carbamate |
|---|---|
| PubChem CID | 67684676 |
| Molecular Formula | C19H29NO4 |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | tert-butyl N-[2-(2-cyclopentyl-2-hydroxyethyl)-4-methoxyphenyl]carbamate |
| SMILES | COc1ccc(NC(=O)OC(C)(C)C)c(CC(O)C2CCCC2)c1 |
| InChI | InChI=1S/C19H29NO4/c1-19(2,3)24-18(22)20-16-10-9-15(23-4)11-14(16)12-17(21)13-7-5-6-8-13/h9-11,13,17,21H,5-8,12H2,1-4H3,(H,20,22) |
| InChIKey | YHHVVGWGXFWPBD-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |