C17H27N3O3 — CID 107239688
tert-butyl N-[4-methoxy-2-(piperidin-3-ylamino)phenyl]carbamate (PubChem CID 107239688) has the molecular formula C17H27N3O3 and a molecular weight of 321.42 g/mol. Its IUPAC name is tert-butyl N-[4-methoxy-2-(piperidin-3-ylamino)phenyl]carbamate.
| Compound Name | tert-butyl N-[4-methoxy-2-(piperidin-3-ylamino)phenyl]carbamate |
|---|---|
| PubChem CID | 107239688 |
| Molecular Formula | C17H27N3O3 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | tert-butyl N-[4-methoxy-2-(piperidin-3-ylamino)phenyl]carbamate |
| SMILES | COc1ccc(NC(=O)OC(C)(C)C)c(NC2CCCNC2)c1 |
| InChI | InChI=1S/C17H27N3O3/c1-17(2,3)23-16(21)20-14-8-7-13(22-4)10-15(14)19-12-6-5-9-18-11-12/h7-8,10,12,18-19H,5-6,9,11H2,1-4H3,(H,20,21) |
| InChIKey | XXCCPWZCOYBCNZ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |