C17H28N2O4 — CID 107239711
tert-butyl N-[4-methoxy-2-(3-methoxybutan-2-ylamino)phenyl]carbamate (PubChem CID 107239711) has the molecular formula C17H28N2O4 and a molecular weight of 324.42 g/mol. Its IUPAC name is tert-butyl N-[4-methoxy-2-(3-methoxybutan-2-ylamino)phenyl]carbamate.
| Compound Name | tert-butyl N-[4-methoxy-2-(3-methoxybutan-2-ylamino)phenyl]carbamate |
|---|---|
| PubChem CID | 107239711 |
| Molecular Formula | C17H28N2O4 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | tert-butyl N-[4-methoxy-2-(3-methoxybutan-2-ylamino)phenyl]carbamate |
| SMILES | COc1ccc(NC(=O)OC(C)(C)C)c(NC(C)C(C)OC)c1 |
| InChI | InChI=1S/C17H28N2O4/c1-11(12(2)21-6)18-15-10-13(22-7)8-9-14(15)19-16(20)23-17(3,4)5/h8-12,18H,1-7H3,(H,19,20) |
| InChIKey | GETGDJPYTHVINJ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |