C23H32N2O4 — CID 68631993
tert-butyl N-[4-[(1S)-1-hydroxy-2-(6-methoxyquinolin-4-yl)ethyl]cyclohexyl]carbamate (PubChem CID 68631993) has the molecular formula C23H32N2O4 and a molecular weight of 400.52 g/mol. Its IUPAC name is tert-butyl N-[4-[(1S)-1-hydroxy-2-(6-methoxyquinolin-4-yl)ethyl]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[(1S)-1-hydroxy-2-(6-methoxyquinolin-4-yl)ethyl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 68631993 |
| Molecular Formula | C23H32N2O4 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | tert-butyl N-[4-[(1S)-1-hydroxy-2-(6-methoxyquinolin-4-yl)ethyl]cyclohexyl]carbamate |
| SMILES | COc1ccc2nccc(C[C@H](O)C3CCC(NC(=O)OC(C)(C)C)CC3)c2c1 |
| InChI | InChI=1S/C23H32N2O4/c1-23(2,3)29-22(27)25-17-7-5-15(6-8-17)21(26)13-16-11-12-24-20-10-9-18(28-4)14-19(16)20/h9-12,14-15,17,21,26H,5-8,13H2,1-4H3,(H,25,27)/t15?,17?,21-/m0/s1 |
| InChIKey | BIFIVZFDNZHUKR-GRXDXKALSA-N |
| XLogP | 4.23 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |