C24H31ClN2O3 — CID 71118498
tert-butyl N-[4-[3-(3-chloro-6-methoxyquinolin-4-yl)prop-1-enyl]cyclohexyl]carbamate (PubChem CID 71118498) has the molecular formula C24H31ClN2O3 and a molecular weight of 430.98 g/mol. Its IUPAC name is tert-butyl N-[4-[3-(3-chloro-6-methoxyquinolin-4-yl)prop-1-enyl]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[3-(3-chloro-6-methoxyquinolin-4-yl)prop-1-enyl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 71118498 |
| Molecular Formula | C24H31ClN2O3 |
| Molecular Weight | 430.98 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | tert-butyl N-[4-[3-(3-chloro-6-methoxyquinolin-4-yl)prop-1-enyl]cyclohexyl]carbamate |
| SMILES | COc1ccc2ncc(Cl)c(CC=CC3CCC(NC(=O)OC(C)(C)C)CC3)c2c1 |
| InChI | InChI=1S/C24H31ClN2O3/c1-24(2,3)30-23(28)27-17-10-8-16(9-11-17)6-5-7-19-20-14-18(29-4)12-13-22(20)26-15-21(19)25/h5-6,12-17H,7-11H2,1-4H3,(H,27,28) |
| InChIKey | NOMIOJYNAWXKMT-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.98 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|